| 1998-06-20 | A new model for the reduced form of purple acid phosphatase: Structure and properties of [Fe2BPLMP(OAc)(2)](BPh4)(2) | Yim, SH; Lee, HJ; Lee, KB; Kang, SJ; Hur, NH; Jang, HG |
| 2005-12 | Simple method to correct gene-specific dye bias from partial dye swap information of a DNA microarray experiment | Kim, BS; Kang, SJ; Lee-, SB; Hwang, W; Kim, KS |
| 1996-07-03 | Subtle ring size effects on bonding mode. Structures and properties of platinum(II) complexes involving sulfur-containing dicarboxylate ligands S-(CH2)(n)-S-C=C(COO-)(2) (n=2,3,4) | Sohn, YS; Kim, KM; Kang, SJ; Jung, OS |
| 1997-03-20 | Synthesis and characterization of [Ho(hfa)(3)(H2O)(2)]center dot triglyme; Molecular assembly of the potential rare-earth CVD precursor | Kang, SJ; Jung, YS; Sohn, YS |
| 1998-02-20 | Synthesis and characterization of holmium complexes containing beta-diketonate ligands | Lee, JH; Jung, YS; Sohn, YS; Kang, SJ |
| 1997-01-20 | Synthesis and characterization of volatile and thermally stable europium beta-diketonate complexes | Kang, SJ; Jung, YS; Sohn, YS |
| 1996-03-13 | Unique fluxional behavior. Synthesis, structure, and properties of novel (diamine)platinum(II) complexes of 9-fluorenylidene- and benzhydrylidenemalonate ligands | Lee, YA; Jung, OS; Kang, SJ; Lee, KB; Sohn, YS |
