Full metadata record
| DC Field | Value | Language |
|---|---|---|
| dc.contributor.author | Seok-Bae Cha | - |
| dc.contributor.author | Kim Byung Kook | - |
| dc.contributor.author | 한경란 | - |
| dc.contributor.author | 박순자 | - |
| dc.date.accessioned | 2024-01-13T20:34:25Z | - |
| dc.date.available | 2024-01-13T20:34:25Z | - |
| dc.date.created | 2021-09-29 | - |
| dc.identifier.uri | https://pubs.kist.re.kr/handle/201004/111228 | - |
| dc.language | English | - |
| dc.subject | ordering structure | - |
| dc.title | Influences of A-site La3+ substitution on the B-site cationic ordering structures of Pb(Mg1/3Nb2/3)O3-Pb(Zn1/3Nb2/3)O3 solid solutions | - |
| dc.type | Conference | - |
| dc.description.journalClass | 1 | - |
| dc.identifier.bibliographicCitation | Proceedings of the 14th Korea-Japan seminar on new ceramics, pp.31 - 34 | - |
| dc.citation.title | Proceedings of the 14th Korea-Japan seminar on new ceramics | - |
| dc.citation.startPage | 31 | - |
| dc.citation.endPage | 34 | - |
| dc.citation.conferencePlace | JA | - |
Items in DSpace are protected by copyright, with all rights reserved, unless otherwise indicated.