Full metadata record
| DC Field | Value | Language |
|---|---|---|
| dc.contributor.author | Batjargal, Tserennyam | - |
| dc.contributor.author | Yang, Jung-Seok | - |
| dc.contributor.author | Kim, Do-Hyung | - |
| dc.contributor.author | Baek, Kitae | - |
| dc.date.accessioned | 2024-01-20T17:04:05Z | - |
| dc.date.available | 2024-01-20T17:04:05Z | - |
| dc.date.created | 2021-09-02 | - |
| dc.date.issued | 2011-05 | - |
| dc.identifier.issn | 0149-6395 | - |
| dc.identifier.uri | https://pubs.kist.re.kr/handle/201004/130424 | - |
| dc.description.abstract | The removal characteristics of Cd(II), Cu(II), Pb(II), and Zn(II) from model aqueous solutions by 5 natural Mongolian zeolites were investigated. The adsorption of metals on zeolites reached a plateau value within 6h. The adsorption kinetic data were fitted with adsorption kinetic models. The equilibrium adsorption capacity of the zeolites was measured and fitted using Langmuir and Freundlich isotherm models. The order of adsorption capacity of zeolite was Pb(II)Zn(II)Cu(II)Cd(II). The maximum adsorption capacity of natural zeolite depends on its cation exchange capacity and pH. The leaching properties of metals were simulated using four leaching solutions. The results show that natural zeolite can be used as an adsorbent for metal ions from aqueous solutions or as a stabilizer for metal-contaminated soils. | - |
| dc.language | English | - |
| dc.publisher | TAYLOR & FRANCIS INC | - |
| dc.subject | HEAVY-METALS | - |
| dc.subject | ADSORPTION CHARACTERISTICS | - |
| dc.subject | AQUEOUS-SOLUTIONS | - |
| dc.subject | ION-EXCHANGE | - |
| dc.subject | SOIL | - |
| dc.subject | ACID | - |
| dc.subject | PRECIPITATION | - |
| dc.subject | STABILIZATION | - |
| dc.subject | REMEDIATION | - |
| dc.subject | KINETICS | - |
| dc.title | Removal Characteristics of Cd(II), Cu(II), Pb(II), and Zn(II) by Natural Mongolian Zeolite through Batch and Column Experiments | - |
| dc.type | Article | - |
| dc.identifier.doi | 10.1080/01496395.2010.551394 | - |
| dc.description.journalClass | 1 | - |
| dc.identifier.bibliographicCitation | SEPARATION SCIENCE AND TECHNOLOGY, v.46, no.8, pp.1313 - 1320 | - |
| dc.citation.title | SEPARATION SCIENCE AND TECHNOLOGY | - |
| dc.citation.volume | 46 | - |
| dc.citation.number | 8 | - |
| dc.citation.startPage | 1313 | - |
| dc.citation.endPage | 1320 | - |
| dc.description.journalRegisteredClass | scie | - |
| dc.description.journalRegisteredClass | scopus | - |
| dc.identifier.wosid | 000290967100012 | - |
| dc.identifier.scopusid | 2-s2.0-79957858225 | - |
| dc.relation.journalWebOfScienceCategory | Chemistry, Multidisciplinary | - |
| dc.relation.journalWebOfScienceCategory | Engineering, Chemical | - |
| dc.relation.journalResearchArea | Chemistry | - |
| dc.relation.journalResearchArea | Engineering | - |
| dc.type.docType | Article | - |
| dc.subject.keywordPlus | HEAVY-METALS | - |
| dc.subject.keywordPlus | ADSORPTION CHARACTERISTICS | - |
| dc.subject.keywordPlus | AQUEOUS-SOLUTIONS | - |
| dc.subject.keywordPlus | ION-EXCHANGE | - |
| dc.subject.keywordPlus | SOIL | - |
| dc.subject.keywordPlus | ACID | - |
| dc.subject.keywordPlus | PRECIPITATION | - |
| dc.subject.keywordPlus | STABILIZATION | - |
| dc.subject.keywordPlus | REMEDIATION | - |
| dc.subject.keywordPlus | KINETICS | - |
| dc.subject.keywordAuthor | adsorption isotherm | - |
| dc.subject.keywordAuthor | heavy metals | - |
| dc.subject.keywordAuthor | ion-exchange | - |
| dc.subject.keywordAuthor | natural zeolite | - |
| dc.subject.keywordAuthor | precipitation | - |
Items in DSpace are protected by copyright, with all rights reserved, unless otherwise indicated.